About (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one
(4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one (PubChem CID 6049349) has the molecular formula C11H8Cl2N2O
and a molecular weight of 255.10 g/mol. Its IUPAC name is (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one.
Molecular Properties
| Compound Name | (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one |
| PubChem CID | 6049349 |
| Molecular Formula | C11H8Cl2N2O |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one |
| SMILES | CC1=NNC(=O)/C1=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H8Cl2N2O/c1-6-9(11(16)15-14-6)4-7-2-3-8(12)5-10(7)13/h2-5H,1H3,(H,15,16)/b9-4+ |
| InChIKey | WPSBOEIHJMVOHH-RUDMXATFSA-N |
| XLogP | 2.88 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one?
The IUPAC name of (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one (CID 6049349) is (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one.
What is the SMILES notation for (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one?
The canonical SMILES for (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one is CC1=NNC(=O)/C1=C/c1ccc(Cl)cc1Cl.
What is the InChIKey of (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one?
The InChIKey is WPSBOEIHJMVOHH-RUDMXATFSA-N. The full InChI is InChI=1S/C11H8Cl2N2O/c1-6-9(11(16)15-14-6)4-7-2-3-8(12)5-10(7)13/h2-5H,1H3,(H,15,16)/b9-4+.
What are the key properties of (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one?
(4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one has a molecular weight of 255.10 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-[(2,4-dichlorophenyl)methylidene]-3-methyl-1H-pyrazol-5-one is sourced from PubChem (CID 6049349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).