About 2,3-di(butanoyloxy)propyl butanoate
2,3-di(butanoyloxy)propyl butanoate (PubChem CID 6050) has the molecular formula C15H26O6
and a molecular weight of 302.37 g/mol. Its IUPAC name is 2,3-di(butanoyloxy)propyl butanoate.
Molecular Properties
| Compound Name | 2,3-di(butanoyloxy)propyl butanoate |
| PubChem CID | 6050 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2,3-di(butanoyloxy)propyl butanoate |
| SMILES | CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC |
| InChI | InChI=1S/C15H26O6/c1-4-7-13(16)19-10-12(21-15(18)9-6-3)11-20-14(17)8-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | UYXTWWCETRIEDR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 2,3-di(butanoyloxy)propyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(butanoyloxy)propyl butanoate?
The IUPAC name of 2,3-di(butanoyloxy)propyl butanoate (CID 6050) is 2,3-di(butanoyloxy)propyl butanoate.
What is the SMILES notation for 2,3-di(butanoyloxy)propyl butanoate?
The canonical SMILES for 2,3-di(butanoyloxy)propyl butanoate is CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC.
What is the InChIKey of 2,3-di(butanoyloxy)propyl butanoate?
The InChIKey is UYXTWWCETRIEDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O6/c1-4-7-13(16)19-10-12(21-15(18)9-6-3)11-20-14(17)8-5-2/h12H,4-11H2,1-3H3.
What are the key properties of 2,3-di(butanoyloxy)propyl butanoate?
2,3-di(butanoyloxy)propyl butanoate has a molecular weight of 302.37 g/mol, XLogP of 2.38, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(butanoyloxy)propyl butanoate is sourced from PubChem (CID 6050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).