C11H12N2O3 — CID 60501413
2-cyano-3-(furan-3-yl)-3-oxo-N-propylpropanamide (PubChem CID 60501413) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-cyano-3-(furan-3-yl)-3-oxo-N-propylpropanamide.
| Compound Name | 2-cyano-3-(furan-3-yl)-3-oxo-N-propylpropanamide |
|---|---|
| PubChem CID | 60501413 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-cyano-3-(furan-3-yl)-3-oxo-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C#N)C(=O)c1ccoc1 |
| InChI | InChI=1S/C11H12N2O3/c1-2-4-13-11(15)9(6-12)10(14)8-3-5-16-7-8/h3,5,7,9H,2,4H2,1H3,(H,13,15) |
| InChIKey | HFFZKLQAGVTSAB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|