C18H17F3N4OS — CID 60503061
N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 60503061) has the molecular formula C18H17F3N4OS and a molecular weight of 394.42 g/mol. Its IUPAC name is N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 60503061 |
| Molecular Formula | C18H17F3N4OS |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)COc1ccc(CNc2ncnc3sc4c(c23)CCCC4)cn1 |
| InChI | InChI=1S/C18H17F3N4OS/c19-18(20,21)9-26-14-6-5-11(7-22-14)8-23-16-15-12-3-1-2-4-13(12)27-17(15)25-10-24-16/h5-7,10H,1-4,8-9H2,(H,23,24,25) |
| InChIKey | XWIRFEQZJBNGQG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |