C24H31N3O3 — CID 60503239
2-[4-(2-ethoxybenzoyl)piperazin-1-yl]-N-methyl-N-[(2-methylphenyl)methyl]acetamide (PubChem CID 60503239) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[4-(2-ethoxybenzoyl)piperazin-1-yl]-N-methyl-N-[(2-methylphenyl)methyl]acetamide.
| Compound Name | 2-[4-(2-ethoxybenzoyl)piperazin-1-yl]-N-methyl-N-[(2-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 60503239 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 2-[4-(2-ethoxybenzoyl)piperazin-1-yl]-N-methyl-N-[(2-methylphenyl)methyl]acetamide |
| SMILES | CCOc1ccccc1C(=O)N1CCN(CC(=O)N(C)Cc2ccccc2C)CC1 |
| InChI | InChI=1S/C24H31N3O3/c1-4-30-22-12-8-7-11-21(22)24(29)27-15-13-26(14-16-27)18-23(28)25(3)17-20-10-6-5-9-19(20)2/h5-12H,4,13-18H2,1-3H3 |
| InChIKey | YGDJBZWNRYLPQC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |