About 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile
4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile (PubChem CID 60503392) has the molecular formula C16H10N4O4
and a molecular weight of 322.28 g/mol. Its IUPAC name is 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile.
Molecular Properties
| Compound Name | 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile |
| PubChem CID | 60503392 |
| Molecular Formula | C16H10N4O4 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile |
| SMILES | Cc1nc(-c2cccc(Oc3ccc(C#N)cc3[N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C16H10N4O4/c1-10-18-16(19-24-10)12-3-2-4-13(8-12)23-15-6-5-11(9-17)7-14(15)20(21)22/h2-8H,1H3 |
| InChIKey | LCPAXIPOEIKCNE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 115.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile?
The IUPAC name of 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile (CID 60503392) is 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile.
What is the SMILES notation for 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile?
The canonical SMILES for 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile is Cc1nc(-c2cccc(Oc3ccc(C#N)cc3[N+](=O)[O-])c2)no1.
What is the InChIKey of 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile?
The InChIKey is LCPAXIPOEIKCNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N4O4/c1-10-18-16(19-24-10)12-3-2-4-13(8-12)23-15-6-5-11(9-17)7-14(15)20(21)22/h2-8H,1H3.
What are the key properties of 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile?
4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile has a molecular weight of 322.28 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3-nitrobenzonitrile is sourced from PubChem (CID 60503392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).