C18H33N3O3 — CID 60503720
2-[[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-(2-methoxyethyl)amino]-N,N-dimethylacetamide (PubChem CID 60503720) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-(2-methoxyethyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-(2-methoxyethyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 60503720 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | 2-[[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]-(2-methoxyethyl)amino]-N,N-dimethylacetamide |
| SMILES | COCCN(CC(=O)N(C)C)CC(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C18H33N3O3/c1-19(2)17(22)13-20(11-12-24-3)14-18(23)21-10-6-8-15-7-4-5-9-16(15)21/h15-16H,4-14H2,1-3H3 |
| InChIKey | SNESNYGGLYTJKG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |