C20H27FN4O3 — CID 60505688
1-(4-acetylpiperazin-1-yl)-2-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]ethanone (PubChem CID 60505688) has the molecular formula C20H27FN4O3 and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 60505688 |
| Molecular Formula | C20H27FN4O3 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)CN2CCN(C(=O)c3ccc(C)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C20H27FN4O3/c1-15-3-4-17(13-18(15)21)20(28)25-7-5-22(6-8-25)14-19(27)24-11-9-23(10-12-24)16(2)26/h3-4,13H,5-12,14H2,1-2H3 |
| InChIKey | YHFSDPIWHKRUIJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |