C7H5F2NO3 — CID 605060
1,3-difluoro-2-methoxy-5-nitrobenzene (PubChem CID 605060) has the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. Its IUPAC name is 1,3-difluoro-2-methoxy-5-nitrobenzene.
| Compound Name | 1,3-difluoro-2-methoxy-5-nitrobenzene |
|---|---|
| PubChem CID | 605060 |
| Molecular Formula | C7H5F2NO3 |
| Molecular Weight | 189.12 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 1,3-difluoro-2-methoxy-5-nitrobenzene |
| SMILES | COc1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C7H5F2NO3/c1-13-7-5(8)2-4(10(11)12)3-6(7)9/h2-3H,1H3 |
| InChIKey | HHWLNWSVKHLZDB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.12 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|