C23H30N2O2S — CID 60507562
2-(4-benzoylpiperidin-1-yl)-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)acetamide (PubChem CID 60507562) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is 2-(4-benzoylpiperidin-1-yl)-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)acetamide.
| Compound Name | 2-(4-benzoylpiperidin-1-yl)-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)acetamide |
|---|---|
| PubChem CID | 60507562 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-(4-benzoylpiperidin-1-yl)-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)acetamide |
| SMILES | CC(C)(C)C(NC(=O)CN1CCC(C(=O)c2ccccc2)CC1)c1cccs1 |
| InChI | InChI=1S/C23H30N2O2S/c1-23(2,3)22(19-10-7-15-28-19)24-20(26)16-25-13-11-18(12-14-25)21(27)17-8-5-4-6-9-17/h4-10,15,18,22H,11-14,16H2,1-3H3,(H,24,26) |
| InChIKey | SEHKEOBKEQWATM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |