About 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile
2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile (PubChem CID 605082) has the molecular formula C11H11N5O2
and a molecular weight of 245.24 g/mol. Its IUPAC name is 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile |
| PubChem CID | 605082 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile |
| SMILES | COc1ccc(-c2nnn(CC#N)n2)cc1OC |
| InChI | InChI=1S/C11H11N5O2/c1-17-9-4-3-8(7-10(9)18-2)11-13-15-16(14-11)6-5-12/h3-4,7H,6H2,1-2H3 |
| InChIKey | YBERIBFMTCFSOL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 85.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile?
The IUPAC name of 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile (CID 605082) is 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile.
What is the SMILES notation for 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile?
The canonical SMILES for 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile is COc1ccc(-c2nnn(CC#N)n2)cc1OC.
What is the InChIKey of 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile?
The InChIKey is YBERIBFMTCFSOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5O2/c1-17-9-4-3-8(7-10(9)18-2)11-13-15-16(14-11)6-5-12/h3-4,7H,6H2,1-2H3.
What are the key properties of 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile?
2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile has a molecular weight of 245.24 g/mol, XLogP of 0.88, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetonitrile is sourced from PubChem (CID 605082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).