C17H15FN4O2S — CID 60508290
5-[(3-fluorobenzoyl)amino]-3-methyl-N-(1-methylpyrazol-4-yl)thiophene-2-carboxamide (PubChem CID 60508290) has the molecular formula C17H15FN4O2S and a molecular weight of 358.40 g/mol. Its IUPAC name is 5-[(3-fluorobenzoyl)amino]-3-methyl-N-(1-methylpyrazol-4-yl)thiophene-2-carboxamide.
| Compound Name | 5-[(3-fluorobenzoyl)amino]-3-methyl-N-(1-methylpyrazol-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 60508290 |
| Molecular Formula | C17H15FN4O2S |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 5-[(3-fluorobenzoyl)amino]-3-methyl-N-(1-methylpyrazol-4-yl)thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cccc(F)c2)sc1C(=O)Nc1cnn(C)c1 |
| InChI | InChI=1S/C17H15FN4O2S/c1-10-6-14(21-16(23)11-4-3-5-12(18)7-11)25-15(10)17(24)20-13-8-19-22(2)9-13/h3-9H,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | HWVPPLHSWWUEOI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |