About 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine
2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine (PubChem CID 60509567) has the molecular formula C21H26N4O4
and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine.
Molecular Properties
| Compound Name | 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine |
| PubChem CID | 60509567 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine |
| SMILES | CC1CN(CCc2ccc([N+](=O)[O-])cc2)CCN1CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H26N4O4/c1-17-16-22(12-10-18-2-6-20(7-3-18)24(26)27)14-15-23(17)13-11-19-4-8-21(9-5-19)25(28)29/h2-9,17H,10-16H2,1H3 |
| InChIKey | AOWSHKSCOCMIOV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine?
The IUPAC name of 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine (CID 60509567) is 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine.
What is the SMILES notation for 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine?
The canonical SMILES for 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine is CC1CN(CCc2ccc([N+](=O)[O-])cc2)CCN1CCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine?
The InChIKey is AOWSHKSCOCMIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O4/c1-17-16-22(12-10-18-2-6-20(7-3-18)24(26)27)14-15-23(17)13-11-19-4-8-21(9-5-19)25(28)29/h2-9,17H,10-16H2,1H3.
What are the key properties of 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine?
2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine has a molecular weight of 398.46 g/mol, XLogP of 3.29, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,4-bis[2-(4-nitrophenyl)ethyl]piperazine is sourced from PubChem (CID 60509567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).