C15H17BrN4O3 — CID 60509666
2-(2-bromo-4-methylphenoxy)-N'-(4-methoxypyrimidin-2-yl)propanehydrazide (PubChem CID 60509666) has the molecular formula C15H17BrN4O3 and a molecular weight of 381.23 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N'-(4-methoxypyrimidin-2-yl)propanehydrazide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N'-(4-methoxypyrimidin-2-yl)propanehydrazide |
|---|---|
| PubChem CID | 60509666 |
| Molecular Formula | C15H17BrN4O3 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N'-(4-methoxypyrimidin-2-yl)propanehydrazide |
| SMILES | COc1ccnc(NNC(=O)C(C)Oc2ccc(C)cc2Br)n1 |
| InChI | InChI=1S/C15H17BrN4O3/c1-9-4-5-12(11(16)8-9)23-10(2)14(21)19-20-15-17-7-6-13(18-15)22-3/h4-8,10H,1-3H3,(H,19,21)(H,17,18,20) |
| InChIKey | FIRGYAAHTAVGJS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|