C14H19ClN2O3 — CID 60509972
N-(3-chloro-4-methoxyphenyl)-2-[cyclopropyl(2-hydroxyethyl)amino]acetamide (PubChem CID 60509972) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[cyclopropyl(2-hydroxyethyl)amino]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[cyclopropyl(2-hydroxyethyl)amino]acetamide |
|---|---|
| PubChem CID | 60509972 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[cyclopropyl(2-hydroxyethyl)amino]acetamide |
| SMILES | COc1ccc(NC(=O)CN(CCO)C2CC2)cc1Cl |
| InChI | InChI=1S/C14H19ClN2O3/c1-20-13-5-2-10(8-12(13)15)16-14(19)9-17(6-7-18)11-3-4-11/h2,5,8,11,18H,3-4,6-7,9H2,1H3,(H,16,19) |
| InChIKey | YCSODIIKDIMTBY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |