About 4-phenyldiazenylaniline
4-phenyldiazenylaniline (PubChem CID 6051) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-phenyldiazenylaniline.
Molecular Properties
| Compound Name | 4-phenyldiazenylaniline |
| PubChem CID | 6051 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4-phenyldiazenylaniline |
| SMILES | Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N3/c13-10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11/h1-9H,13H2/b15-14+ |
| InChIKey | QPQKUYVSJWQSDY-CCEZHUSRSA-N |
| XLogP | 3.68 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyldiazenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyldiazenylaniline?
The IUPAC name of 4-phenyldiazenylaniline (CID 6051) is 4-phenyldiazenylaniline.
What is the SMILES notation for 4-phenyldiazenylaniline?
The canonical SMILES for 4-phenyldiazenylaniline is Nc1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of 4-phenyldiazenylaniline?
The InChIKey is QPQKUYVSJWQSDY-CCEZHUSRSA-N. The full InChI is InChI=1S/C12H11N3/c13-10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11/h1-9H,13H2/b15-14+.
What are the key properties of 4-phenyldiazenylaniline?
4-phenyldiazenylaniline has a molecular weight of 197.24 g/mol, XLogP of 3.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyldiazenylaniline is sourced from PubChem (CID 6051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).