C20H19ClN4O4S — CID 60510799
N-[4-[2-[2-[(2-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylfuran-3-carboxamide (PubChem CID 60510799) has the molecular formula C20H19ClN4O4S and a molecular weight of 446.92 g/mol. Its IUPAC name is N-[4-[2-[2-[(2-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[4-[2-[2-[(2-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 60510799 |
| Molecular Formula | C20H19ClN4O4S |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | N-[4-[2-[2-[(2-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)Nc1nc(CC(=O)NCCNC(=O)c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C20H19ClN4O4S/c1-12-14(6-9-29-12)19(28)25-20-24-13(11-30-20)10-17(26)22-7-8-23-18(27)15-4-2-3-5-16(15)21/h2-6,9,11H,7-8,10H2,1H3,(H,22,26)(H,23,27)(H,24,25,28) |
| InChIKey | NWRZQZORXYEJLB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|