C17H18BrFN2O4S — CID 60511603
N-[1-(5-bromo-3-methylfuran-2-carbonyl)piperidin-4-yl]-4-fluorobenzenesulfonamide (PubChem CID 60511603) has the molecular formula C17H18BrFN2O4S and a molecular weight of 445.31 g/mol. Its IUPAC name is N-[1-(5-bromo-3-methylfuran-2-carbonyl)piperidin-4-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[1-(5-bromo-3-methylfuran-2-carbonyl)piperidin-4-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 60511603 |
| Molecular Formula | C17H18BrFN2O4S |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | N-[1-(5-bromo-3-methylfuran-2-carbonyl)piperidin-4-yl]-4-fluorobenzenesulfonamide |
| SMILES | Cc1cc(Br)oc1C(=O)N1CCC(NS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H18BrFN2O4S/c1-11-10-15(18)25-16(11)17(22)21-8-6-13(7-9-21)20-26(23,24)14-4-2-12(19)3-5-14/h2-5,10,13,20H,6-9H2,1H3 |
| InChIKey | IICICONEVGFIRU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |