C22H25ClFN3O3 — CID 60511702
N-(5-chloro-2-hydroxyphenyl)-1-[1-(5-fluoro-2-methylanilino)-1-oxopropan-2-yl]piperidine-4-carboxamide (PubChem CID 60511702) has the molecular formula C22H25ClFN3O3 and a molecular weight of 433.91 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1-[1-(5-fluoro-2-methylanilino)-1-oxopropan-2-yl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1-[1-(5-fluoro-2-methylanilino)-1-oxopropan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60511702 |
| Molecular Formula | C22H25ClFN3O3 |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1-[1-(5-fluoro-2-methylanilino)-1-oxopropan-2-yl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(F)cc1NC(=O)C(C)N1CCC(C(=O)Nc2cc(Cl)ccc2O)CC1 |
| InChI | InChI=1S/C22H25ClFN3O3/c1-13-3-5-17(24)12-18(13)25-21(29)14(2)27-9-7-15(8-10-27)22(30)26-19-11-16(23)4-6-20(19)28/h3-6,11-12,14-15,28H,7-10H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | GHJUAQYQXZPZMF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|