C20H17N5OS — CID 60512430
N-(3-cyanothiolan-3-yl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 60512430) has the molecular formula C20H17N5OS and a molecular weight of 375.46 g/mol. Its IUPAC name is N-(3-cyanothiolan-3-yl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(3-cyanothiolan-3-yl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 60512430 |
| Molecular Formula | C20H17N5OS |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-(3-cyanothiolan-3-yl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | N#CC1(NC(=O)c2nc(-c3ccccc3)n(-c3ccccc3)n2)CCSC1 |
| InChI | InChI=1S/C20H17N5OS/c21-13-20(11-12-27-14-20)23-19(26)17-22-18(15-7-3-1-4-8-15)25(24-17)16-9-5-2-6-10-16/h1-10H,11-12,14H2,(H,23,26) |
| InChIKey | LBHJKVKELNHHPW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |