C23H24F3N5O3 — CID 60512750
5-[1-[4-[(2-methyl-3-nitrophenyl)methyl]piperazin-1-yl]ethyl]-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole (PubChem CID 60512750) has the molecular formula C23H24F3N5O3 and a molecular weight of 475.47 g/mol. Its IUPAC name is 5-[1-[4-[(2-methyl-3-nitrophenyl)methyl]piperazin-1-yl]ethyl]-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[1-[4-[(2-methyl-3-nitrophenyl)methyl]piperazin-1-yl]ethyl]-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 60512750 |
| Molecular Formula | C23H24F3N5O3 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 5-[1-[4-[(2-methyl-3-nitrophenyl)methyl]piperazin-1-yl]ethyl]-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| SMILES | Cc1c(CN2CCN(C(C)c3nc(-c4cccc(C(F)(F)F)c4)no3)CC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H24F3N5O3/c1-15-18(6-4-8-20(15)31(32)33)14-29-9-11-30(12-10-29)16(2)22-27-21(28-34-22)17-5-3-7-19(13-17)23(24,25)26/h3-8,13,16H,9-12,14H2,1-2H3 |
| InChIKey | HMYGLKLZMBTRIY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 88.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|