C20H26ClN3O3S — CID 60513164
2-[(3-chlorophenyl)methyl-propan-2-ylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 60513164) has the molecular formula C20H26ClN3O3S and a molecular weight of 423.97 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-propan-2-ylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[(3-chlorophenyl)methyl-propan-2-ylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 60513164 |
| Molecular Formula | C20H26ClN3O3S |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-propan-2-ylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CC(C)N(CC(=O)NCCc1ccc(S(N)(=O)=O)cc1)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H26ClN3O3S/c1-15(2)24(13-17-4-3-5-18(21)12-17)14-20(25)23-11-10-16-6-8-19(9-7-16)28(22,26)27/h3-9,12,15H,10-11,13-14H2,1-2H3,(H,23,25)(H2,22,26,27) |
| InChIKey | ZFWMARYWXDMFJI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |