About 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile
4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile (PubChem CID 605132) has the molecular formula C12H10ClN3O
and a molecular weight of 247.68 g/mol. Its IUPAC name is 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile |
| PubChem CID | 605132 |
| Molecular Formula | C12H10ClN3O |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cc(Cl)c(N2CCOCC2)cc1C#N |
| InChI | InChI=1S/C12H10ClN3O/c13-11-5-9(7-14)10(8-15)6-12(11)16-1-3-17-4-2-16/h5-6H,1-4H2 |
| InChIKey | VPWNQSVHOJKQAV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile?
The IUPAC name of 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile (CID 605132) is 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile?
The canonical SMILES for 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile is N#Cc1cc(Cl)c(N2CCOCC2)cc1C#N.
What is the InChIKey of 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile?
The InChIKey is VPWNQSVHOJKQAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3O/c13-11-5-9(7-14)10(8-15)6-12(11)16-1-3-17-4-2-16/h5-6H,1-4H2.
What are the key properties of 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile?
4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile has a molecular weight of 247.68 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-morpholin-4-ylbenzene-1,2-dicarbonitrile is sourced from PubChem (CID 605132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).