C16H16N4O4S — CID 60513827
5-nitro-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 60513827) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is 5-nitro-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-nitro-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 60513827 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 5-nitro-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccncc2)CC1)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C16H16N4O4S/c21-15(13-1-2-14(25-13)20(23)24)18-12-5-9-19(10-6-12)16(22)11-3-7-17-8-4-11/h1-4,7-8,12H,5-6,9-10H2,(H,18,21) |
| InChIKey | WWZAZWHDCGYNHI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|