C22H30N4O3S — CID 60513950
N-[4-(dimethylamino)-2-methylphenyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 60513950) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methylphenyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-[4-(dimethylamino)-2-methylphenyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 60513950 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[4-(dimethylamino)-2-methylphenyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CC(=O)Nc3ccc(N(C)C)cc3C)CC2)cc1 |
| InChI | InChI=1S/C22H30N4O3S/c1-17-5-8-20(9-6-17)30(28,29)26-13-11-25(12-14-26)16-22(27)23-21-10-7-19(24(3)4)15-18(21)2/h5-10,15H,11-14,16H2,1-4H3,(H,23,27) |
| InChIKey | VQPQOTDQPPGGPP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|