C13H15F2N3OS2 — CID 60514341
5-[1-(2,6-difluorophenyl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 60514341) has the molecular formula C13H15F2N3OS2 and a molecular weight of 331.41 g/mol. Its IUPAC name is 5-[1-(2,6-difluorophenyl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[1-(2,6-difluorophenyl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 60514341 |
| Molecular Formula | C13H15F2N3OS2 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 5-[1-(2,6-difluorophenyl)ethylsulfanyl]-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COCCNc1nnc(SC(C)c2c(F)cccc2F)s1 |
| InChI | InChI=1S/C13H15F2N3OS2/c1-8(11-9(14)4-3-5-10(11)15)20-13-18-17-12(21-13)16-6-7-19-2/h3-5,8H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | HNQOAGMBXVBZAE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|