C18H16N6O4S — CID 60514500
5-methyl-3-[[2-(1-methylpyrazol-4-yl)-1,3-thiazol-4-yl]methyl]-5-(4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 60514500) has the molecular formula C18H16N6O4S and a molecular weight of 412.43 g/mol. Its IUPAC name is 5-methyl-3-[[2-(1-methylpyrazol-4-yl)-1,3-thiazol-4-yl]methyl]-5-(4-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-[[2-(1-methylpyrazol-4-yl)-1,3-thiazol-4-yl]methyl]-5-(4-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60514500 |
| Molecular Formula | C18H16N6O4S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 5-methyl-3-[[2-(1-methylpyrazol-4-yl)-1,3-thiazol-4-yl]methyl]-5-(4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | Cn1cc(-c2nc(CN3C(=O)NC(C)(c4ccc([N+](=O)[O-])cc4)C3=O)cs2)cn1 |
| InChI | InChI=1S/C18H16N6O4S/c1-18(12-3-5-14(6-4-12)24(27)28)16(25)23(17(26)21-18)9-13-10-29-15(20-13)11-7-19-22(2)8-11/h3-8,10H,9H2,1-2H3,(H,21,26) |
| InChIKey | RKHDZONRTIQODD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|