C22H25N3O2 — CID 60515084
N-[[3-(butanoylamino)phenyl]methyl]-4,6-dimethyl-1H-indole-2-carboxamide (PubChem CID 60515084) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[[3-(butanoylamino)phenyl]methyl]-4,6-dimethyl-1H-indole-2-carboxamide.
| Compound Name | N-[[3-(butanoylamino)phenyl]methyl]-4,6-dimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 60515084 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-[[3-(butanoylamino)phenyl]methyl]-4,6-dimethyl-1H-indole-2-carboxamide |
| SMILES | CCCC(=O)Nc1cccc(CNC(=O)c2cc3c(C)cc(C)cc3[nH]2)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-4-6-21(26)24-17-8-5-7-16(11-17)13-23-22(27)20-12-18-15(3)9-14(2)10-19(18)25-20/h5,7-12,25H,4,6,13H2,1-3H3,(H,23,27)(H,24,26) |
| InChIKey | BVCRCLVEUNHDJZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |