C17H21BrN4O2S — CID 60515117
N-[5-[(4-bromo-3-methylphenyl)methyl]-1,3-thiazol-2-yl]-5-(carbamoylamino)pentanamide (PubChem CID 60515117) has the molecular formula C17H21BrN4O2S and a molecular weight of 425.35 g/mol. Its IUPAC name is N-[5-[(4-bromo-3-methylphenyl)methyl]-1,3-thiazol-2-yl]-5-(carbamoylamino)pentanamide.
| Compound Name | N-[5-[(4-bromo-3-methylphenyl)methyl]-1,3-thiazol-2-yl]-5-(carbamoylamino)pentanamide |
|---|---|
| PubChem CID | 60515117 |
| Molecular Formula | C17H21BrN4O2S |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | N-[5-[(4-bromo-3-methylphenyl)methyl]-1,3-thiazol-2-yl]-5-(carbamoylamino)pentanamide |
| SMILES | Cc1cc(Cc2cnc(NC(=O)CCCCNC(N)=O)s2)ccc1Br |
| InChI | InChI=1S/C17H21BrN4O2S/c1-11-8-12(5-6-14(11)18)9-13-10-21-17(25-13)22-15(23)4-2-3-7-20-16(19)24/h5-6,8,10H,2-4,7,9H2,1H3,(H3,19,20,24)(H,21,22,23) |
| InChIKey | ZMQOKGYIIUTEDU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|