About 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one
3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one (PubChem CID 60515820) has the molecular formula C19H15N3O4S3
and a molecular weight of 445.55 g/mol. Its IUPAC name is 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 60515820 |
| Molecular Formula | C19H15N3O4S3 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cn1c(SCCOc2ccccc2[N+](=O)[O-])nc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C19H15N3O4S3/c1-21-18(23)16-12(15-7-4-9-27-15)11-29-17(16)20-19(21)28-10-8-26-14-6-3-2-5-13(14)22(24)25/h2-7,9,11H,8,10H2,1H3 |
| InChIKey | XTLXTCXSHWBNKU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one (CID 60515820) is 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one is Cn1c(SCCOc2ccccc2[N+](=O)[O-])nc2scc(-c3cccs3)c2c1=O.
What is the InChIKey of 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one?
The InChIKey is XTLXTCXSHWBNKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O4S3/c1-21-18(23)16-12(15-7-4-9-27-15)11-29-17(16)20-19(21)28-10-8-26-14-6-3-2-5-13(14)22(24)25/h2-7,9,11H,8,10H2,1H3.
What are the key properties of 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one?
3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one has a molecular weight of 445.55 g/mol, XLogP of 4.80, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-[2-(2-nitrophenoxy)ethylsulfanyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 60515820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).