C18H16F2N2OS — CID 60516393
2-[1-(2,6-difluorophenyl)ethylsulfanyl]-3-ethylquinazolin-4-one (PubChem CID 60516393) has the molecular formula C18H16F2N2OS and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-[1-(2,6-difluorophenyl)ethylsulfanyl]-3-ethylquinazolin-4-one.
| Compound Name | 2-[1-(2,6-difluorophenyl)ethylsulfanyl]-3-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 60516393 |
| Molecular Formula | C18H16F2N2OS |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[1-(2,6-difluorophenyl)ethylsulfanyl]-3-ethylquinazolin-4-one |
| SMILES | CCn1c(SC(C)c2c(F)cccc2F)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H16F2N2OS/c1-3-22-17(23)12-7-4-5-10-15(12)21-18(22)24-11(2)16-13(19)8-6-9-14(16)20/h4-11H,3H2,1-2H3 |
| InChIKey | HTNQEMHBZZXAIW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |