C23H27N5OS — CID 60516958
2-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methylsulfanyl]-3-hexylquinazolin-4-one (PubChem CID 60516958) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methylsulfanyl]-3-hexylquinazolin-4-one.
| Compound Name | 2-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methylsulfanyl]-3-hexylquinazolin-4-one |
|---|---|
| PubChem CID | 60516958 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methylsulfanyl]-3-hexylquinazolin-4-one |
| SMILES | CCCCCCn1c(SCc2cn3c(C)cc(C)nc3n2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H27N5OS/c1-4-5-6-9-12-27-21(29)19-10-7-8-11-20(19)26-23(27)30-15-18-14-28-17(3)13-16(2)24-22(28)25-18/h7-8,10-11,13-14H,4-6,9,12,15H2,1-3H3 |
| InChIKey | HILVHGGXRZFTTG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 65.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|