C23H27N5O2S — CID 60517527
3-[2-[[5-(3,5-dimethylpiperidin-1-yl)-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile (PubChem CID 60517527) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 3-[2-[[5-(3,5-dimethylpiperidin-1-yl)-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile.
| Compound Name | 3-[2-[[5-(3,5-dimethylpiperidin-1-yl)-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 60517527 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 3-[2-[[5-(3,5-dimethylpiperidin-1-yl)-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
| SMILES | CC1CC(C)CN(c2nnc(SCCOc3cccc(C#N)c3)n2Cc2ccco2)C1 |
| InChI | InChI=1S/C23H27N5O2S/c1-17-11-18(2)15-27(14-17)22-25-26-23(28(22)16-21-7-4-8-29-21)31-10-9-30-20-6-3-5-19(12-20)13-24/h3-8,12,17-18H,9-11,14-16H2,1-2H3 |
| InChIKey | DTGUDHLZQASYEV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|