C18H30 — CID 605179
3,6,9-triethyl-3,6,9-trimethyltetracyclo[6.1.0.02,4.05,7]nonane (PubChem CID 605179) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 3,6,9-triethyl-3,6,9-trimethyltetracyclo[6.1.0.02,4.05,7]nonane.
| Compound Name | 3,6,9-triethyl-3,6,9-trimethyltetracyclo[6.1.0.02,4.05,7]nonane |
|---|---|
| PubChem CID | 605179 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 3,6,9-triethyl-3,6,9-trimethyltetracyclo[6.1.0.02,4.05,7]nonane |
| SMILES | CCC1(C)C2C3C(C4C(C21)C4(C)CC)C3(C)CC |
| InChI | InChI=1S/C18H30/c1-7-16(4)10-11(16)13-15(18(13,6)9-3)14-12(10)17(14,5)8-2/h10-15H,7-9H2,1-6H3 |
| InChIKey | DZHLMBGZVCWBCF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |