C17H16FIN2O4 — CID 60518362
N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-4-fluoro-2-iodobenzamide (PubChem CID 60518362) has the molecular formula C17H16FIN2O4 and a molecular weight of 458.23 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-4-fluoro-2-iodobenzamide.
| Compound Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-4-fluoro-2-iodobenzamide |
|---|---|
| PubChem CID | 60518362 |
| Molecular Formula | C17H16FIN2O4 |
| Molecular Weight | 458.23 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-4-fluoro-2-iodobenzamide |
| SMILES | COc1cc(CNC(=O)c2ccc(F)cc2I)ccc1OCC(N)=O |
| InChI | InChI=1S/C17H16FIN2O4/c1-24-15-6-10(2-5-14(15)25-9-16(20)22)8-21-17(23)12-4-3-11(18)7-13(12)19/h2-7H,8-9H2,1H3,(H2,20,22)(H,21,23) |
| InChIKey | IBSKLUGKQPABLZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|