C22H28N2O2S — CID 60519343
N-(2-methyl-2-morpholin-4-ylpropyl)-2-(4-phenylphenyl)sulfanylacetamide (PubChem CID 60519343) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is N-(2-methyl-2-morpholin-4-ylpropyl)-2-(4-phenylphenyl)sulfanylacetamide.
| Compound Name | N-(2-methyl-2-morpholin-4-ylpropyl)-2-(4-phenylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 60519343 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N-(2-methyl-2-morpholin-4-ylpropyl)-2-(4-phenylphenyl)sulfanylacetamide |
| SMILES | CC(C)(CNC(=O)CSc1ccc(-c2ccccc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H28N2O2S/c1-22(2,24-12-14-26-15-13-24)17-23-21(25)16-27-20-10-8-19(9-11-20)18-6-4-3-5-7-18/h3-11H,12-17H2,1-2H3,(H,23,25) |
| InChIKey | JEDWEDHYZZMRCB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |