C11H10N6O3S — CID 60519360
5,6-dimethyl-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 60519360) has the molecular formula C11H10N6O3S and a molecular weight of 306.31 g/mol. Its IUPAC name is 5,6-dimethyl-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 60519360 |
| Molecular Formula | C11H10N6O3S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 5,6-dimethyl-2-[(3-nitro-1,2,4-triazol-1-yl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(Cn3cnc([N+](=O)[O-])n3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C11H10N6O3S/c1-5-6(2)21-10-8(5)9(18)13-7(14-10)3-16-4-12-11(15-16)17(19)20/h4H,3H2,1-2H3,(H,13,14,18) |
| InChIKey | YSQBXAZUVRMDCF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|