About methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate
methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate (PubChem CID 6051946) has the molecular formula C19H14Cl3N3O3
and a molecular weight of 438.70 g/mol. Its IUPAC name is methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate |
| PubChem CID | 6051946 |
| Molecular Formula | C19H14Cl3N3O3 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2ccccc2)c(Cl)c1/C=N\OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H14Cl3N3O3/c1-27-19(26)17-13(18(22)25(24-17)12-6-3-2-4-7-12)10-23-28-11-14-15(20)8-5-9-16(14)21/h2-10H,11H2,1H3/b23-10- |
| InChIKey | OSUZGKQOCFHSAM-RMORIDSASA-N |
| XLogP | 5.17 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate?
The IUPAC name of methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate (CID 6051946) is methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate.
What is the SMILES notation for methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate?
The canonical SMILES for methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate is COC(=O)c1nn(-c2ccccc2)c(Cl)c1/C=N\OCc1c(Cl)cccc1Cl.
What is the InChIKey of methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate?
The InChIKey is OSUZGKQOCFHSAM-RMORIDSASA-N. The full InChI is InChI=1S/C19H14Cl3N3O3/c1-27-19(26)17-13(18(22)25(24-17)12-6-3-2-4-7-12)10-23-28-11-14-15(20)8-5-9-16(14)21/h2-10H,11H2,1H3/b23-10-.
What are the key properties of methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate?
methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate has a molecular weight of 438.70 g/mol, XLogP of 5.17, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-chloro-4-[(Z)-(2,6-dichlorophenyl)methoxyiminomethyl]-1-phenylpyrazole-3-carboxylate is sourced from PubChem (CID 6051946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).