C16H19Cl2N3O2 — CID 60520123
3,5-dichloro-N-(2-cyanoethyl)-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 60520123) has the molecular formula C16H19Cl2N3O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-cyanoethyl)-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 3,5-dichloro-N-(2-cyanoethyl)-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 60520123 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 3,5-dichloro-N-(2-cyanoethyl)-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | N#CCCN(CCN1CCOCC1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2N3O2/c17-14-10-13(11-15(18)12-14)16(22)21(3-1-2-19)5-4-20-6-8-23-9-7-20/h10-12H,1,3-9H2 |
| InChIKey | VOWZODNSXYHHQF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |