About 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine
5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 60520840) has the molecular formula C15H15N5S
and a molecular weight of 297.39 g/mol. Its IUPAC name is 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| PubChem CID | 60520840 |
| Molecular Formula | C15H15N5S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | Cc1ccc(-n2nnnc2N2CCc3sccc3C2)cc1 |
| InChI | InChI=1S/C15H15N5S/c1-11-2-4-13(5-3-11)20-15(16-17-18-20)19-8-6-14-12(10-19)7-9-21-14/h2-5,7,9H,6,8,10H2,1H3 |
| InChIKey | SMHJPFJZWAQKOA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The IUPAC name of 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (CID 60520840) is 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
What is the SMILES notation for 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The canonical SMILES for 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine is Cc1ccc(-n2nnnc2N2CCc3sccc3C2)cc1.
What is the InChIKey of 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The InChIKey is SMHJPFJZWAQKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5S/c1-11-2-4-13(5-3-11)20-15(16-17-18-20)19-8-6-14-12(10-19)7-9-21-14/h2-5,7,9H,6,8,10H2,1H3.
What are the key properties of 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine has a molecular weight of 297.39 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(4-methylphenyl)tetrazol-5-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine is sourced from PubChem (CID 60520840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).