C19H23N5O2S — CID 60521222
N-[3-[(4-cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)amino]propyl]-N-ethylmethanesulfonamide (PubChem CID 60521222) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[3-[(4-cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)amino]propyl]-N-ethylmethanesulfonamide.
| Compound Name | N-[3-[(4-cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)amino]propyl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 60521222 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[3-[(4-cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)amino]propyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(CCCNc1cc(C)c(C#N)c2nc3ccccc3n12)S(C)(=O)=O |
| InChI | InChI=1S/C19H23N5O2S/c1-4-23(27(3,25)26)11-7-10-21-18-12-14(2)15(13-20)19-22-16-8-5-6-9-17(16)24(18)19/h5-6,8-9,12,21H,4,7,10-11H2,1-3H3 |
| InChIKey | SMLWNMCAUFJLLH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|