C14H14FN5O2S — CID 60522976
3-[3-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione (PubChem CID 60522976) has the molecular formula C14H14FN5O2S and a molecular weight of 335.36 g/mol. Its IUPAC name is 3-[3-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60522976 |
| Molecular Formula | C14H14FN5O2S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3-[3-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCSc1n[nH]c(-c2ccccc2F)n1 |
| InChI | InChI=1S/C14H14FN5O2S/c15-10-5-2-1-4-9(10)12-17-13(19-18-12)23-7-3-6-20-11(21)8-16-14(20)22/h1-2,4-5H,3,6-8H2,(H,16,22)(H,17,18,19) |
| InChIKey | FQZJGHPXZIMYIU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|