C19H22N4O2S — CID 60523156
1-(1,2,3,4-tetrahydronaphthalene-1-carbonyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide (PubChem CID 60523156) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalene-1-carbonyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalene-1-carbonyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60523156 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalene-1-carbonyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1nncs1)C1CCN(C(=O)C2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C19H22N4O2S/c24-17(21-19-22-20-12-26-19)14-8-10-23(11-9-14)18(25)16-7-3-5-13-4-1-2-6-15(13)16/h1-2,4,6,12,14,16H,3,5,7-11H2,(H,21,22,24) |
| InChIKey | LBBFGOSHOODEHX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |