C18H19N5O2S2 — CID 60524448
3-[(5-nitrothiophen-3-yl)methylsulfanyl]-4-phenyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazole (PubChem CID 60524448) has the molecular formula C18H19N5O2S2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 3-[(5-nitrothiophen-3-yl)methylsulfanyl]-4-phenyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazole.
| Compound Name | 3-[(5-nitrothiophen-3-yl)methylsulfanyl]-4-phenyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 60524448 |
| Molecular Formula | C18H19N5O2S2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 3-[(5-nitrothiophen-3-yl)methylsulfanyl]-4-phenyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cc(CSc2nnc(CN3CCCC3)n2-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H19N5O2S2/c24-23(25)17-10-14(12-26-17)13-27-18-20-19-16(11-21-8-4-5-9-21)22(18)15-6-2-1-3-7-15/h1-3,6-7,10,12H,4-5,8-9,11,13H2 |
| InChIKey | HZZRYDQERCKOIA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|