C20H15N5O2 — CID 60525572
N-(2-phenoxyphenyl)-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide (PubChem CID 60525572) has the molecular formula C20H15N5O2 and a molecular weight of 357.37 g/mol. Its IUPAC name is N-(2-phenoxyphenyl)-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide.
| Compound Name | N-(2-phenoxyphenyl)-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 60525572 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-(2-phenoxyphenyl)-2-(1,2,4-triazol-1-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)c1ccnc(-n2cncn2)c1 |
| InChI | InChI=1S/C20H15N5O2/c26-20(15-10-11-22-19(12-15)25-14-21-13-23-25)24-17-8-4-5-9-18(17)27-16-6-2-1-3-7-16/h1-14H,(H,24,26) |
| InChIKey | GLXCFDSDRHLDQB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |