C14H15N3O2 — CID 60526057
spiro[1H-indole-3,3'-2,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine]-1',2-dione (PubChem CID 60526057) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is spiro[1H-indole-3,3'-2,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine]-1',2-dione.
| Compound Name | spiro[1H-indole-3,3'-2,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine]-1',2-dione |
|---|---|
| PubChem CID | 60526057 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | spiro[1H-indole-3,3'-2,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine]-1',2-dione |
| SMILES | O=C1NC2(C(=O)Nc3ccccc32)N2CCCCC12 |
| InChI | InChI=1S/C14H15N3O2/c18-12-11-7-3-4-8-17(11)14(16-12)9-5-1-2-6-10(9)15-13(14)19/h1-2,5-6,11H,3-4,7-8H2,(H,15,19)(H,16,18) |
| InChIKey | PWIDQGJYWQOVNP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |