About 8-hydroxy-2,4-dimethylchromen-7-one
8-hydroxy-2,4-dimethylchromen-7-one (PubChem CID 605263) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is 8-hydroxy-2,4-dimethylchromen-7-one.
Molecular Properties
| Compound Name | 8-hydroxy-2,4-dimethylchromen-7-one |
| PubChem CID | 605263 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 8-hydroxy-2,4-dimethylchromen-7-one |
| SMILES | Cc1cc(C)c2ccc(=O)c(O)c-2o1 |
| InChI | InChI=1S/C11H10O3/c1-6-5-7(2)14-11-8(6)3-4-9(12)10(11)13/h3-5,13H,1-2H3 |
| InChIKey | BFLQOVKTKWLIQY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-hydroxy-2,4-dimethylchromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-2,4-dimethylchromen-7-one?
The IUPAC name of 8-hydroxy-2,4-dimethylchromen-7-one (CID 605263) is 8-hydroxy-2,4-dimethylchromen-7-one.
What is the SMILES notation for 8-hydroxy-2,4-dimethylchromen-7-one?
The canonical SMILES for 8-hydroxy-2,4-dimethylchromen-7-one is Cc1cc(C)c2ccc(=O)c(O)c-2o1.
What is the InChIKey of 8-hydroxy-2,4-dimethylchromen-7-one?
The InChIKey is BFLQOVKTKWLIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c1-6-5-7(2)14-11-8(6)3-4-9(12)10(11)13/h3-5,13H,1-2H3.
What are the key properties of 8-hydroxy-2,4-dimethylchromen-7-one?
8-hydroxy-2,4-dimethylchromen-7-one has a molecular weight of 190.20 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-2,4-dimethylchromen-7-one is sourced from PubChem (CID 605263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).