C18H18F4N2O3 — CID 60526456
3-(4-fluorophenyl)-1-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-methylurea (PubChem CID 60526456) has the molecular formula C18H18F4N2O3 and a molecular weight of 386.35 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-methylurea.
| Compound Name | 3-(4-fluorophenyl)-1-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-methylurea |
|---|---|
| PubChem CID | 60526456 |
| Molecular Formula | C18H18F4N2O3 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-methylurea |
| SMILES | CN(CC(O)COc1ccc(C(F)(F)F)cc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H18F4N2O3/c1-24(17(26)23-14-6-4-13(19)5-7-14)10-15(25)11-27-16-8-2-12(3-9-16)18(20,21)22/h2-9,15,25H,10-11H2,1H3,(H,23,26) |
| InChIKey | PQPXIBVVGRRWET-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |