C20H19F3N6O2S — CID 60526504
4-cyclopropyl-2-[[(2-nitrophenyl)methyl-(2,2,2-trifluoroethyl)amino]methyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione (PubChem CID 60526504) has the molecular formula C20H19F3N6O2S and a molecular weight of 464.47 g/mol. Its IUPAC name is 4-cyclopropyl-2-[[(2-nitrophenyl)methyl-(2,2,2-trifluoroethyl)amino]methyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-cyclopropyl-2-[[(2-nitrophenyl)methyl-(2,2,2-trifluoroethyl)amino]methyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 60526504 |
| Molecular Formula | C20H19F3N6O2S |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 4-cyclopropyl-2-[[(2-nitrophenyl)methyl-(2,2,2-trifluoroethyl)amino]methyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione |
| SMILES | O=[N+]([O-])c1ccccc1CN(Cn1nc(-c2cccnc2)n(C2CC2)c1=S)CC(F)(F)F |
| InChI | InChI=1S/C20H19F3N6O2S/c21-20(22,23)12-26(11-15-4-1-2-6-17(15)29(30)31)13-27-19(32)28(16-7-8-16)18(25-27)14-5-3-9-24-10-14/h1-6,9-10,16H,7-8,11-13H2 |
| InChIKey | UJFWRNBFZTYKCD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|