C17H23FN4S — CID 60526630
2-[[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]-4-propan-2-yl-1,2,4-triazole-3-thione (PubChem CID 60526630) has the molecular formula C17H23FN4S and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-[[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]-4-propan-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]-4-propan-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 60526630 |
| Molecular Formula | C17H23FN4S |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]-4-propan-2-yl-1,2,4-triazole-3-thione |
| SMILES | CC(C)n1cnn(CN2CCCC2Cc2cccc(F)c2)c1=S |
| InChI | InChI=1S/C17H23FN4S/c1-13(2)21-11-19-22(17(21)23)12-20-8-4-7-16(20)10-14-5-3-6-15(18)9-14/h3,5-6,9,11,13,16H,4,7-8,10,12H2,1-2H3 |
| InChIKey | IDSYFJPJEKAEBF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|